termék neve |
4-[4-(oxiran-2-ylmethoxy)phenyl]-1,2,3-thiadiazole |
MF |
C11H10N2O2S |
Molekulatömeg |
234.2743 |
InChI |
InChI=1/C11H10N2O2S/c1-3-9(14-5-10-6-15-10)4-2-8(1)11-7-16-13-12-11/h1-4,7,10H,5-6H2 |
CAS-szám |
59834-07-0 |
Molekuláris szerkezete |
|
Sűrűség |
1.339g/cm3 |
Olvadáspont |
70℃ |
Forráspont |
405.6°C at 760 mmHg |
Törésmutató |
1.613 |
Gyulladáspont |
199.1°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|